C17H16F3NO2 — CID 127043691
(S)-pyridin-2-yl-[1-[3-(trifluoromethoxy)phenyl]cyclobutyl]methanol (PubChem CID 127043691) has the molecular formula C17H16F3NO2 and a molecular weight of 323.31 g/mol. Its IUPAC name is (S)-pyridin-2-yl-[1-[3-(trifluoromethoxy)phenyl]cyclobutyl]methanol.
| Compound Name | (S)-pyridin-2-yl-[1-[3-(trifluoromethoxy)phenyl]cyclobutyl]methanol |
|---|---|
| PubChem CID | 127043691 |
| Molecular Formula | C17H16F3NO2 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (S)-pyridin-2-yl-[1-[3-(trifluoromethoxy)phenyl]cyclobutyl]methanol |
| SMILES | O[C@H](c1ccccn1)C1(c2cccc(OC(F)(F)F)c2)CCC1 |
| InChI | InChI=1S/C17H16F3NO2/c18-17(19,20)23-13-6-3-5-12(11-13)16(8-4-9-16)15(22)14-7-1-2-10-21-14/h1-3,5-7,10-11,15,22H,4,8-9H2/t15-/m1/s1 |
| InChIKey | CQQMAKVCVBNQEN-OAHLLOKOSA-N |
| XLogP | 4.14 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |