C23H22Cl2N4O2 — CID 127043919
4-[[3-chloro-5-(4-chlorophenoxy)phenyl]methyl]-N-pyridin-3-ylpiperazine-1-carboxamide (PubChem CID 127043919) has the molecular formula C23H22Cl2N4O2 and a molecular weight of 457.36 g/mol. Its IUPAC name is 4-[[3-chloro-5-(4-chlorophenoxy)phenyl]methyl]-N-pyridin-3-ylpiperazine-1-carboxamide.
| Compound Name | 4-[[3-chloro-5-(4-chlorophenoxy)phenyl]methyl]-N-pyridin-3-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 127043919 |
| Molecular Formula | C23H22Cl2N4O2 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 4-[[3-chloro-5-(4-chlorophenoxy)phenyl]methyl]-N-pyridin-3-ylpiperazine-1-carboxamide |
| SMILES | O=C(Nc1cccnc1)N1CCN(Cc2cc(Cl)cc(Oc3ccc(Cl)cc3)c2)CC1 |
| InChI | InChI=1S/C23H22Cl2N4O2/c24-18-3-5-21(6-4-18)31-22-13-17(12-19(25)14-22)16-28-8-10-29(11-9-28)23(30)27-20-2-1-7-26-15-20/h1-7,12-15H,8-11,16H2,(H,27,30) |
| InChIKey | IDIWVJJNQDQXPV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |