About 2-[4-(trifluoromethyl)phenyl]-1H-imidazo[4,5-g]quinoline
2-[4-(trifluoromethyl)phenyl]-1H-imidazo[4,5-g]quinoline (PubChem CID 127044079) has the molecular formula C17H10F3N3
and a molecular weight of 313.28 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]-1H-imidazo[4,5-g]quinoline.
Molecular Properties
| Compound Name | 2-[4-(trifluoromethyl)phenyl]-1H-imidazo[4,5-g]quinoline |
| PubChem CID | 127044079 |
| Molecular Formula | C17H10F3N3 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]-1H-imidazo[4,5-g]quinoline |
| SMILES | FC(F)(F)c1ccc(-c2nc3cc4ncccc4cc3[nH]2)cc1 |
| InChI | InChI=1S/C17H10F3N3/c18-17(19,20)12-5-3-10(4-6-12)16-22-14-8-11-2-1-7-21-13(11)9-15(14)23-16/h1-9H,(H,22,23) |
| InChIKey | IWGQVGXPJSAYRB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-(trifluoromethyl)phenyl]-1H-imidazo[4,5-g]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(trifluoromethyl)phenyl]-1H-imidazo[4,5-g]quinoline?
The IUPAC name of 2-[4-(trifluoromethyl)phenyl]-1H-imidazo[4,5-g]quinoline (CID 127044079) is 2-[4-(trifluoromethyl)phenyl]-1H-imidazo[4,5-g]quinoline.
What is the SMILES notation for 2-[4-(trifluoromethyl)phenyl]-1H-imidazo[4,5-g]quinoline?
The canonical SMILES for 2-[4-(trifluoromethyl)phenyl]-1H-imidazo[4,5-g]quinoline is FC(F)(F)c1ccc(-c2nc3cc4ncccc4cc3[nH]2)cc1.
What is the InChIKey of 2-[4-(trifluoromethyl)phenyl]-1H-imidazo[4,5-g]quinoline?
The InChIKey is IWGQVGXPJSAYRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F3N3/c18-17(19,20)12-5-3-10(4-6-12)16-22-14-8-11-2-1-7-21-13(11)9-15(14)23-16/h1-9H,(H,22,23).
What are the key properties of 2-[4-(trifluoromethyl)phenyl]-1H-imidazo[4,5-g]quinoline?
2-[4-(trifluoromethyl)phenyl]-1H-imidazo[4,5-g]quinoline has a molecular weight of 313.28 g/mol, XLogP of 4.80, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(trifluoromethyl)phenyl]-1H-imidazo[4,5-g]quinoline is sourced from PubChem (CID 127044079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).