C15H10BrN5 — CID 2428
N-(3-bromophenyl)-1H-imidazo[4,5-g]quinazolin-8-amine (PubChem CID 2428) has the molecular formula C15H10BrN5 and a molecular weight of 340.18 g/mol. Its IUPAC name is N-(3-bromophenyl)-1H-imidazo[4,5-g]quinazolin-8-amine.
| Compound Name | N-(3-bromophenyl)-1H-imidazo[4,5-g]quinazolin-8-amine |
|---|---|
| PubChem CID | 2428 |
| Molecular Formula | C15H10BrN5 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | N-(3-bromophenyl)-1H-imidazo[4,5-g]quinazolin-8-amine |
| SMILES | Brc1cccc(Nc2ncnc3cc4nc[nH]c4cc23)c1 |
| InChI | InChI=1S/C15H10BrN5/c16-9-2-1-3-10(4-9)21-15-11-5-13-14(19-7-18-13)6-12(11)17-8-20-15/h1-8H,(H,18,19)(H,17,20,21) |
| InChIKey | BZHDPIVTQKXAQQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |