C25H33N3O5 — CID 127045601
2-(4-amino-3-methyl-5-propan-2-ylphenoxy)-1-[4-(2,3-dimethoxybenzoyl)piperazin-1-yl]ethanone (PubChem CID 127045601) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-(4-amino-3-methyl-5-propan-2-ylphenoxy)-1-[4-(2,3-dimethoxybenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-amino-3-methyl-5-propan-2-ylphenoxy)-1-[4-(2,3-dimethoxybenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 127045601 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 2-(4-amino-3-methyl-5-propan-2-ylphenoxy)-1-[4-(2,3-dimethoxybenzoyl)piperazin-1-yl]ethanone |
| SMILES | COc1cccc(C(=O)N2CCN(C(=O)COc3cc(C)c(N)c(C(C)C)c3)CC2)c1OC |
| InChI | InChI=1S/C25H33N3O5/c1-16(2)20-14-18(13-17(3)23(20)26)33-15-22(29)27-9-11-28(12-10-27)25(30)19-7-6-8-21(31-4)24(19)32-5/h6-8,13-14,16H,9-12,15,26H2,1-5H3 |
| InChIKey | NTPFHEIVQSYNEH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|