C35H33N3O9 — CID 127045891
4-[2-[4-[[2-methoxy-4-[(1E,4E)-3-oxo-5-(3,4,5-trimethoxyphenyl)penta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethoxy]chromen-2-one (PubChem CID 127045891) has the molecular formula C35H33N3O9 and a molecular weight of 639.66 g/mol. Its IUPAC name is 4-[2-[4-[[2-methoxy-4-[(1E,4E)-3-oxo-5-(3,4,5-trimethoxyphenyl)penta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethoxy]chromen-2-one.
| Compound Name | 4-[2-[4-[[2-methoxy-4-[(1E,4E)-3-oxo-5-(3,4,5-trimethoxyphenyl)penta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethoxy]chromen-2-one |
|---|---|
| PubChem CID | 127045891 |
| Molecular Formula | C35H33N3O9 |
| Molecular Weight | 639.66 g/mol |
| Exact Mass | 639.22 |
| IUPAC Name | 4-[2-[4-[[2-methoxy-4-[(1E,4E)-3-oxo-5-(3,4,5-trimethoxyphenyl)penta-1,4-dienyl]phenoxy]methyl]triazol-1-yl]ethoxy]chromen-2-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)ccc1OCc1cn(CCOc2cc(=O)oc3ccccc23)nn1 |
| InChI | InChI=1S/C35H33N3O9/c1-41-31-17-23(9-12-26(39)13-10-24-18-32(42-2)35(44-4)33(19-24)43-3)11-14-29(31)46-22-25-21-38(37-36-25)15-16-45-30-20-34(40)47-28-8-6-5-7-27(28)30/h5-14,17-21H,15-16,22H2,1-4H3/b12-9+,13-10+ |
| InChIKey | IVKKWVXMLWHWOJ-JOWSBRCASA-N |
| XLogP | 5.37 |
| TPSA | 133.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.66 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|