C19H16F3N7O4 — CID 127046148
1-(6-amino-3,5-difluoro-2-pyridinyl)-7-[(2S,3E)-2-(aminomethyl)-3-methoxyiminoazetidin-1-yl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 127046148) has the molecular formula C19H16F3N7O4 and a molecular weight of 463.38 g/mol. Its IUPAC name is 1-(6-amino-3,5-difluoro-2-pyridinyl)-7-[(2S,3E)-2-(aminomethyl)-3-methoxyiminoazetidin-1-yl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 1-(6-amino-3,5-difluoro-2-pyridinyl)-7-[(2S,3E)-2-(aminomethyl)-3-methoxyiminoazetidin-1-yl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 127046148 |
| Molecular Formula | C19H16F3N7O4 |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 1-(6-amino-3,5-difluoro-2-pyridinyl)-7-[(2S,3E)-2-(aminomethyl)-3-methoxyiminoazetidin-1-yl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | CO/N=C1\CN(c2nc3c(cc2F)c(=O)c(C(=O)O)cn3-c2nc(N)c(F)cc2F)[C@H]1CN |
| InChI | InChI=1S/C19H16F3N7O4/c1-33-27-12-6-28(13(12)4-23)18-10(21)2-7-14(30)8(19(31)32)5-29(16(7)26-18)17-11(22)3-9(20)15(24)25-17/h2-3,5,13H,4,6,23H2,1H3,(H2,24,25)(H,31,32)/b27-12+/t13-/m0/s1 |
| InChIKey | RJFNYVOTFDNNOU-PKCARXMOSA-N |
| XLogP | 0.63 |
| TPSA | 161.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|