C29H29N3O — CID 127046364
3-methyl-N-[2-(4-methylpiperazin-1-yl)-5-naphthalen-2-ylphenyl]benzamide (PubChem CID 127046364) has the molecular formula C29H29N3O and a molecular weight of 435.57 g/mol. Its IUPAC name is 3-methyl-N-[2-(4-methylpiperazin-1-yl)-5-naphthalen-2-ylphenyl]benzamide.
| Compound Name | 3-methyl-N-[2-(4-methylpiperazin-1-yl)-5-naphthalen-2-ylphenyl]benzamide |
|---|---|
| PubChem CID | 127046364 |
| Molecular Formula | C29H29N3O |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 3-methyl-N-[2-(4-methylpiperazin-1-yl)-5-naphthalen-2-ylphenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2cc(-c3ccc4ccccc4c3)ccc2N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C29H29N3O/c1-21-6-5-9-26(18-21)29(33)30-27-20-25(12-13-28(27)32-16-14-31(2)15-17-32)24-11-10-22-7-3-4-8-23(22)19-24/h3-13,18-20H,14-17H2,1-2H3,(H,30,33) |
| InChIKey | ZVUPHWDFGWNIOA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |