C25H34ClN5S2 — CID 127046514
1-pentyl-3-[6-(pentylcarbamothioylamino)acridin-3-yl]thiourea;hydrochloride (PubChem CID 127046514) has the molecular formula C25H34ClN5S2 and a molecular weight of 504.17 g/mol. Its IUPAC name is 1-pentyl-3-[6-(pentylcarbamothioylamino)acridin-3-yl]thiourea;hydrochloride.
| Compound Name | 1-pentyl-3-[6-(pentylcarbamothioylamino)acridin-3-yl]thiourea;hydrochloride |
|---|---|
| PubChem CID | 127046514 |
| Molecular Formula | C25H34ClN5S2 |
| Molecular Weight | 504.17 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 1-pentyl-3-[6-(pentylcarbamothioylamino)acridin-3-yl]thiourea;hydrochloride |
| SMILES | CCCCCNC(=S)Nc1ccc2cc3ccc(NC(=S)NCCCCC)cc3nc2c1.Cl |
| InChI | InChI=1S/C25H33N5S2.ClH/c1-3-5-7-13-26-24(31)28-20-11-9-18-15-19-10-12-21(17-23(19)30-22(18)16-20)29-25(32)27-14-8-6-4-2;/h9-12,15-17H,3-8,13-14H2,1-2H3,(H2,26,28,31)(H2,27,29,32);1H |
| InChIKey | AHEUTZHVYLTGQF-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.17 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|