C29H34N4O — CID 127047303
3-methyl-N-[2-(4-methylpiperazin-1-yl)-5-(4-pyrrolidin-1-ylphenyl)phenyl]benzamide (PubChem CID 127047303) has the molecular formula C29H34N4O and a molecular weight of 454.62 g/mol. Its IUPAC name is 3-methyl-N-[2-(4-methylpiperazin-1-yl)-5-(4-pyrrolidin-1-ylphenyl)phenyl]benzamide.
| Compound Name | 3-methyl-N-[2-(4-methylpiperazin-1-yl)-5-(4-pyrrolidin-1-ylphenyl)phenyl]benzamide |
|---|---|
| PubChem CID | 127047303 |
| Molecular Formula | C29H34N4O |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 3-methyl-N-[2-(4-methylpiperazin-1-yl)-5-(4-pyrrolidin-1-ylphenyl)phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2cc(-c3ccc(N4CCCC4)cc3)ccc2N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C29H34N4O/c1-22-6-5-7-25(20-22)29(34)30-27-21-24(10-13-28(27)33-18-16-31(2)17-19-33)23-8-11-26(12-9-23)32-14-3-4-15-32/h5-13,20-21H,3-4,14-19H2,1-2H3,(H,30,34) |
| InChIKey | NAZXGYDCKZBYTB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |