C16H13N5O — CID 127047851
2-benzyl-5-(furan-2-yl)pyrazolo[4,3-d]pyrimidin-7-amine (PubChem CID 127047851) has the molecular formula C16H13N5O and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-benzyl-5-(furan-2-yl)pyrazolo[4,3-d]pyrimidin-7-amine.
| Compound Name | 2-benzyl-5-(furan-2-yl)pyrazolo[4,3-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 127047851 |
| Molecular Formula | C16H13N5O |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-benzyl-5-(furan-2-yl)pyrazolo[4,3-d]pyrimidin-7-amine |
| SMILES | Nc1nc(-c2ccco2)nc2cn(Cc3ccccc3)nc12 |
| InChI | InChI=1S/C16H13N5O/c17-15-14-12(18-16(19-15)13-7-4-8-22-13)10-21(20-14)9-11-5-2-1-3-6-11/h1-8,10H,9H2,(H2,17,18,19) |
| InChIKey | WHRXEWMAKBKKKJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |