C20H21NO — CID 127048636
(E)-N-(1-benzofuran-7-ylmethyl)-N-ethyl-3-phenylprop-2-en-1-amine (PubChem CID 127048636) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is (E)-N-(1-benzofuran-7-ylmethyl)-N-ethyl-3-phenylprop-2-en-1-amine.
| Compound Name | (E)-N-(1-benzofuran-7-ylmethyl)-N-ethyl-3-phenylprop-2-en-1-amine |
|---|---|
| PubChem CID | 127048636 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (E)-N-(1-benzofuran-7-ylmethyl)-N-ethyl-3-phenylprop-2-en-1-amine |
| SMILES | CCN(C/C=C/c1ccccc1)Cc1cccc2ccoc12 |
| InChI | InChI=1S/C20H21NO/c1-2-21(14-7-10-17-8-4-3-5-9-17)16-19-12-6-11-18-13-15-22-20(18)19/h3-13,15H,2,14,16H2,1H3/b10-7+ |
| InChIKey | OMLILEWDSGADFS-JXMROGBWSA-N |
| XLogP | 4.97 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |