C19H20ClNO — CID 127048961
(E)-N-(1-benzofuran-4-ylmethyl)-N-methyl-3-phenylprop-2-en-1-amine;hydrochloride (PubChem CID 127048961) has the molecular formula C19H20ClNO and a molecular weight of 313.83 g/mol. Its IUPAC name is (E)-N-(1-benzofuran-4-ylmethyl)-N-methyl-3-phenylprop-2-en-1-amine;hydrochloride.
| Compound Name | (E)-N-(1-benzofuran-4-ylmethyl)-N-methyl-3-phenylprop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 127048961 |
| Molecular Formula | C19H20ClNO |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (E)-N-(1-benzofuran-4-ylmethyl)-N-methyl-3-phenylprop-2-en-1-amine;hydrochloride |
| SMILES | CN(C/C=C/c1ccccc1)Cc1cccc2occc12.Cl |
| InChI | InChI=1S/C19H19NO.ClH/c1-20(13-6-9-16-7-3-2-4-8-16)15-17-10-5-11-19-18(17)12-14-21-19;/h2-12,14H,13,15H2,1H3;1H/b9-6+; |
| InChIKey | RULRSQBJAJOHFG-MLBSPLJJSA-N |
| XLogP | 5.00 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |