C27H25NO — CID 134559949
(2E,4E)-N-(1-benzofuran-3-ylmethyl)-N-methyl-5-(4-phenylphenyl)penta-2,4-dien-1-amine (PubChem CID 134559949) has the molecular formula C27H25NO and a molecular weight of 379.50 g/mol. Its IUPAC name is (2E,4E)-N-(1-benzofuran-3-ylmethyl)-N-methyl-5-(4-phenylphenyl)penta-2,4-dien-1-amine.
| Compound Name | (2E,4E)-N-(1-benzofuran-3-ylmethyl)-N-methyl-5-(4-phenylphenyl)penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 134559949 |
| Molecular Formula | C27H25NO |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (2E,4E)-N-(1-benzofuran-3-ylmethyl)-N-methyl-5-(4-phenylphenyl)penta-2,4-dien-1-amine |
| SMILES | CN(C/C=C/C=C/c1ccc(-c2ccccc2)cc1)Cc1coc2ccccc12 |
| InChI | InChI=1S/C27H25NO/c1-28(20-25-21-29-27-14-8-7-13-26(25)27)19-9-3-4-10-22-15-17-24(18-16-22)23-11-5-2-6-12-23/h2-18,21H,19-20H2,1H3/b9-3+,10-4+ |
| InChIKey | WKLJBRLUCKGURS-LQIBPGRFSA-N |
| XLogP | 6.80 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|