C23H24F3NO — CID 142355183
(E)-N-(1-benzofuran-3-ylmethyl)-N-methyl-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-amine;prop-1-ene (PubChem CID 142355183) has the molecular formula C23H24F3NO and a molecular weight of 387.45 g/mol. Its IUPAC name is (E)-N-(1-benzofuran-3-ylmethyl)-N-methyl-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-amine;prop-1-ene.
| Compound Name | (E)-N-(1-benzofuran-3-ylmethyl)-N-methyl-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-amine;prop-1-ene |
|---|---|
| PubChem CID | 142355183 |
| Molecular Formula | C23H24F3NO |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (E)-N-(1-benzofuran-3-ylmethyl)-N-methyl-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-amine;prop-1-ene |
| SMILES | C=CC.CN(C/C=C/c1ccc(C(F)(F)F)cc1)Cc1coc2ccccc12 |
| InChI | InChI=1S/C20H18F3NO.C3H6/c1-24(13-16-14-25-19-7-3-2-6-18(16)19)12-4-5-15-8-10-17(11-9-15)20(21,22)23;1-3-2/h2-11,14H,12-13H2,1H3;3H,1H2,2H3/b5-4+; |
| InChIKey | VRINOWGMNZMZDJ-FXRZFVDSSA-N |
| XLogP | 6.79 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|