C19H25NO — CID 134559936
(E)-N-(1-benzofuran-3-ylmethyl)-3-cyclohexyl-N-methylprop-2-en-1-amine (PubChem CID 134559936) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is (E)-N-(1-benzofuran-3-ylmethyl)-3-cyclohexyl-N-methylprop-2-en-1-amine.
| Compound Name | (E)-N-(1-benzofuran-3-ylmethyl)-3-cyclohexyl-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 134559936 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (E)-N-(1-benzofuran-3-ylmethyl)-3-cyclohexyl-N-methylprop-2-en-1-amine |
| SMILES | CN(C/C=C/C1CCCCC1)Cc1coc2ccccc12 |
| InChI | InChI=1S/C19H25NO/c1-20(13-7-10-16-8-3-2-4-9-16)14-17-15-21-19-12-6-5-11-18(17)19/h5-7,10-12,15-16H,2-4,8-9,13-14H2,1H3/b10-7+ |
| InChIKey | YVXSXJFBFQPHRJ-JXMROGBWSA-N |
| XLogP | 5.00 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|