About (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-fluoroanilino)prop-2-en-1-one
(Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-fluoroanilino)prop-2-en-1-one (PubChem CID 127050137) has the molecular formula C24H18FN3O
and a molecular weight of 383.43 g/mol. Its IUPAC name is (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-fluoroanilino)prop-2-en-1-one.
Molecular Properties
| Compound Name | (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-fluoroanilino)prop-2-en-1-one |
| PubChem CID | 127050137 |
| Molecular Formula | C24H18FN3O |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-fluoroanilino)prop-2-en-1-one |
| SMILES | O=C(/C=C\Nc1ccc(F)cc1)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H18FN3O/c25-19-11-13-20(14-12-19)26-16-15-23(29)22-17-28(21-9-5-2-6-10-21)27-24(22)18-7-3-1-4-8-18/h1-17,26H/b16-15- |
| InChIKey | KFRVRWSQDNDVJA-NXVVXOECSA-N |
| XLogP | 5.49 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-fluoroanilino)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-fluoroanilino)prop-2-en-1-one?
The IUPAC name of (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-fluoroanilino)prop-2-en-1-one (CID 127050137) is (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-fluoroanilino)prop-2-en-1-one.
What is the SMILES notation for (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-fluoroanilino)prop-2-en-1-one?
The canonical SMILES for (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-fluoroanilino)prop-2-en-1-one is O=C(/C=C\Nc1ccc(F)cc1)c1cn(-c2ccccc2)nc1-c1ccccc1.
What is the InChIKey of (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-fluoroanilino)prop-2-en-1-one?
The InChIKey is KFRVRWSQDNDVJA-NXVVXOECSA-N. The full InChI is InChI=1S/C24H18FN3O/c25-19-11-13-20(14-12-19)26-16-15-23(29)22-17-28(21-9-5-2-6-10-21)27-24(22)18-7-3-1-4-8-18/h1-17,26H/b16-15-.
What are the key properties of (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-fluoroanilino)prop-2-en-1-one?
(Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-fluoroanilino)prop-2-en-1-one has a molecular weight of 383.43 g/mol, XLogP of 5.49, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(1,3-diphenylpyrazol-4-yl)-3-(4-fluoroanilino)prop-2-en-1-one is sourced from PubChem (CID 127050137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).