C4H6N4S — CID 12705219
4,5-diamino-1H-pyridazine-6-thione (PubChem CID 12705219) has the molecular formula C4H6N4S and a molecular weight of 142.19 g/mol. Its IUPAC name is 4,5-diamino-1H-pyridazine-6-thione.
| Compound Name | 4,5-diamino-1H-pyridazine-6-thione |
|---|---|
| PubChem CID | 12705219 |
| Molecular Formula | C4H6N4S |
| Molecular Weight | 142.19 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | 4,5-diamino-1H-pyridazine-6-thione |
| SMILES | Nc1cn[nH]c(=S)c1N |
| InChI | InChI=1S/C4H6N4S/c5-2-1-7-8-4(9)3(2)6/h1H,(H2,6,7)(H3,5,8,9) |
| InChIKey | VQSYPAJEIPFVSF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.19 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|