C5H5N3O — CID 96637932
1H-furo[3,2-d]pyrazol-4-amine (PubChem CID 96637932) has the molecular formula C5H5N3O and a molecular weight of 123.11 g/mol. Its IUPAC name is 1H-furo[3,2-d]pyrazol-4-amine.
| Compound Name | 1H-furo[3,2-d]pyrazol-4-amine |
|---|---|
| PubChem CID | 96637932 |
| Molecular Formula | C5H5N3O |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.04 |
| IUPAC Name | 1H-furo[3,2-d]pyrazol-4-amine |
| SMILES | Nc1coc2[nH]ncc12 |
| InChI | InChI=1S/C5H5N3O/c6-4-2-9-5-3(4)1-7-8-5/h1-2H,6H2,(H,7,8) |
| InChIKey | KVANFXDHRDLIGH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |