C7H10N2O — CID 164596147
ethane;1H-furo[3,2-d]pyrazole (PubChem CID 164596147) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is ethane;1H-furo[3,2-d]pyrazole.
| Compound Name | ethane;1H-furo[3,2-d]pyrazole |
|---|---|
| PubChem CID | 164596147 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | ethane;1H-furo[3,2-d]pyrazole |
| SMILES | CC.c1cc2cn[nH]c2o1 |
| InChI | InChI=1S/C5H4N2O.C2H6/c1-2-8-5-4(1)3-6-7-5;1-2/h1-3H,(H,6,7);1-2H3 |
| InChIKey | MQWAMRATHVAOLM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |