C13H9N3O2 — CID 117350269
4-furo[2,3-f][1]benzofuran-4-yl-1H-pyrazol-5-amine (PubChem CID 117350269) has the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. Its IUPAC name is 4-furo[2,3-f][1]benzofuran-4-yl-1H-pyrazol-5-amine.
| Compound Name | 4-furo[2,3-f][1]benzofuran-4-yl-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117350269 |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 4-furo[2,3-f][1]benzofuran-4-yl-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1-c1c2ccoc2cc2ccoc12 |
| InChI | InChI=1S/C13H9N3O2/c14-13-9(6-15-16-13)11-8-2-4-17-10(8)5-7-1-3-18-12(7)11/h1-6H,(H3,14,15,16) |
| InChIKey | HLEICRQISJQHKH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |