C9H9NO2 — CID 133063762
1-furo[2,3-b]pyridin-6-ylethanol (PubChem CID 133063762) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 1-furo[2,3-b]pyridin-6-ylethanol.
| Compound Name | 1-furo[2,3-b]pyridin-6-ylethanol |
|---|---|
| PubChem CID | 133063762 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 1-furo[2,3-b]pyridin-6-ylethanol |
| SMILES | CC(O)c1ccc2ccoc2n1 |
| InChI | InChI=1S/C9H9NO2/c1-6(11)8-3-2-7-4-5-12-9(7)10-8/h2-6,11H,1H3 |
| InChIKey | ZPWDMBINZIZQLW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |