C9H9N3O2 — CID 140989785
7-(1-hydroxyethyl)-1H-pyrido[2,3-d]pyrimidin-2-one (PubChem CID 140989785) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 7-(1-hydroxyethyl)-1H-pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 7-(1-hydroxyethyl)-1H-pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 140989785 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 7-(1-hydroxyethyl)-1H-pyrido[2,3-d]pyrimidin-2-one |
| SMILES | CC(O)c1ccc2cnc(=O)[nH]c2n1 |
| InChI | InChI=1S/C9H9N3O2/c1-5(13)7-3-2-6-4-10-9(14)12-8(6)11-7/h2-5,13H,1H3,(H,10,11,12,14) |
| InChIKey | FBUNRAPONYACCT-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |