C7H6N4O3S — CID 141021243
2-methylsulfonyl-8H-pyrimido[4,5-d]pyrimidin-7-one (PubChem CID 141021243) has the molecular formula C7H6N4O3S and a molecular weight of 226.22 g/mol. Its IUPAC name is 2-methylsulfonyl-8H-pyrimido[4,5-d]pyrimidin-7-one.
| Compound Name | 2-methylsulfonyl-8H-pyrimido[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 141021243 |
| Molecular Formula | C7H6N4O3S |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 2-methylsulfonyl-8H-pyrimido[4,5-d]pyrimidin-7-one |
| SMILES | CS(=O)(=O)c1ncc2cnc(=O)[nH]c2n1 |
| InChI | InChI=1S/C7H6N4O3S/c1-15(13,14)7-9-3-4-2-8-6(12)10-5(4)11-7/h2-3H,1H3,(H,8,9,10,11,12) |
| InChIKey | JZWRZLYYOJBRSP-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |