C7H9N3O4S — CID 133056015
N-methyl-6-methylsulfonyl-2-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 133056015) has the molecular formula C7H9N3O4S and a molecular weight of 231.23 g/mol. Its IUPAC name is N-methyl-6-methylsulfonyl-2-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-methyl-6-methylsulfonyl-2-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 133056015 |
| Molecular Formula | C7H9N3O4S |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | N-methyl-6-methylsulfonyl-2-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | CNC(=O)c1cnc(=O)[nH]c1S(C)(=O)=O |
| InChI | InChI=1S/C7H9N3O4S/c1-8-5(11)4-3-9-7(12)10-6(4)15(2,13)14/h3H,1-2H3,(H,8,11)(H,9,10,12) |
| InChIKey | RSDPECFIJJEXID-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |