C5H6ClN3O — CID 166893313
5-chloro-N-methyl-1H-imidazole-2-carboxamide (PubChem CID 166893313) has the molecular formula C5H6ClN3O and a molecular weight of 159.58 g/mol. Its IUPAC name is 5-chloro-N-methyl-1H-imidazole-2-carboxamide.
| Compound Name | 5-chloro-N-methyl-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 166893313 |
| Molecular Formula | C5H6ClN3O |
| Molecular Weight | 159.58 g/mol |
| Exact Mass | 159.02 |
| IUPAC Name | 5-chloro-N-methyl-1H-imidazole-2-carboxamide |
| SMILES | CNC(=O)c1ncc(Cl)[nH]1 |
| InChI | InChI=1S/C5H6ClN3O/c1-7-5(10)4-8-2-3(6)9-4/h2H,1H3,(H,7,10)(H,8,9) |
| InChIKey | XTUNCDMMPUFOHT-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.58 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |