C5H6N4O3 — CID 136628558
N-methyl-5,6-dioxo-1,4-dihydro-1,2,4-triazine-3-carboxamide (PubChem CID 136628558) has the molecular formula C5H6N4O3 and a molecular weight of 170.13 g/mol. Its IUPAC name is N-methyl-5,6-dioxo-1,4-dihydro-1,2,4-triazine-3-carboxamide.
| Compound Name | N-methyl-5,6-dioxo-1,4-dihydro-1,2,4-triazine-3-carboxamide |
|---|---|
| PubChem CID | 136628558 |
| Molecular Formula | C5H6N4O3 |
| Molecular Weight | 170.13 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | N-methyl-5,6-dioxo-1,4-dihydro-1,2,4-triazine-3-carboxamide |
| SMILES | CNC(=O)c1n[nH]c(=O)c(=O)[nH]1 |
| InChI | InChI=1S/C5H6N4O3/c1-6-3(10)2-7-4(11)5(12)9-8-2/h1H3,(H,6,10)(H,9,12)(H,7,8,11) |
| InChIKey | BAEPGRZTZCFAAS-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.13 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|