C7H8ClN3O3 — CID 175908373
2-chloro-N-methylpyrimidine-5-carboxamide;formic acid (PubChem CID 175908373) has the molecular formula C7H8ClN3O3 and a molecular weight of 217.61 g/mol. Its IUPAC name is 2-chloro-N-methylpyrimidine-5-carboxamide;formic acid.
| Compound Name | 2-chloro-N-methylpyrimidine-5-carboxamide;formic acid |
|---|---|
| PubChem CID | 175908373 |
| Molecular Formula | C7H8ClN3O3 |
| Molecular Weight | 217.61 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 2-chloro-N-methylpyrimidine-5-carboxamide;formic acid |
| SMILES | CNC(=O)c1cnc(Cl)nc1.O=CO |
| InChI | InChI=1S/C6H6ClN3O.CH2O2/c1-8-5(11)4-2-9-6(7)10-3-4;2-1-3/h2-3H,1H3,(H,8,11);1H,(H,2,3) |
| InChIKey | DNYAQJIOCNIBPW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.61 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|