C9H14N4 — CID 169111088
ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine (PubChem CID 169111088) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine.
| Compound Name | ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 169111088 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine |
| SMILES | CC.Cc1cnc(N)c2cn[nH]c12 |
| InChI | InChI=1S/C7H8N4.C2H6/c1-4-2-9-7(8)5-3-10-11-6(4)5;1-2/h2-3H,1H3,(H2,8,9)(H,10,11);1-2H3 |
| InChIKey | VFYRJQCFQFHGSN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |