About ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine
ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine (PubChem CID 169111088) has the molecular formula C9H14N4
and a molecular weight of 178.24 g/mol. Its IUPAC name is ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine.
Molecular Properties
| Compound Name | ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine |
| PubChem CID | 169111088 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine |
| SMILES | CC.Cc1cnc(N)c2cn[nH]c12 |
| InChI | InChI=1S/C7H8N4.C2H6/c1-4-2-9-7(8)5-3-10-11-6(4)5;1-2/h2-3H,1H3,(H2,8,9)(H,10,11);1-2H3 |
| InChIKey | VFYRJQCFQFHGSN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine?
The IUPAC name of ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine (CID 169111088) is ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine.
What is the SMILES notation for ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine?
The canonical SMILES for ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine is CC.Cc1cnc(N)c2cn[nH]c12.
What is the InChIKey of ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine?
The InChIKey is VFYRJQCFQFHGSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4.C2H6/c1-4-2-9-7(8)5-3-10-11-6(4)5;1-2/h2-3H,1H3,(H2,8,9)(H,10,11);1-2H3.
What are the key properties of ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine?
ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine has a molecular weight of 178.24 g/mol, XLogP of 1.87, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methyl-1H-pyrazolo[4,5-c]pyridin-4-amine is sourced from PubChem (CID 169111088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).