C27H33F3N2O3 — CID 127052476
ethyl 2-[[4-[4-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]piperidin-1-yl]phenyl]methyl]butanoate (PubChem CID 127052476) has the molecular formula C27H33F3N2O3 and a molecular weight of 490.57 g/mol. Its IUPAC name is ethyl 2-[[4-[4-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]piperidin-1-yl]phenyl]methyl]butanoate.
| Compound Name | ethyl 2-[[4-[4-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]piperidin-1-yl]phenyl]methyl]butanoate |
|---|---|
| PubChem CID | 127052476 |
| Molecular Formula | C27H33F3N2O3 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | ethyl 2-[[4-[4-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]piperidin-1-yl]phenyl]methyl]butanoate |
| SMILES | CCOC(=O)C(CC)Cc1ccc(N2CCC(C(=O)NCc3ccccc3C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C27H33F3N2O3/c1-3-20(26(34)35-4-2)17-19-9-11-23(12-10-19)32-15-13-21(14-16-32)25(33)31-18-22-7-5-6-8-24(22)27(28,29)30/h5-12,20-21H,3-4,13-18H2,1-2H3,(H,31,33) |
| InChIKey | SMOQZEPMTCPXNQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|