C23H30N2O2 — CID 21950
View drug profile → piminodineethyl 1-(3-anilinopropyl)-4-phenylpiperidine-4-carboxylate (PubChem CID 21950) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is ethyl 1-(3-anilinopropyl)-4-phenylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-(3-anilinopropyl)-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 21950 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | ethyl 1-(3-anilinopropyl)-4-phenylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(CCCNc2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N2O2/c1-2-27-22(26)23(20-10-5-3-6-11-20)14-18-25(19-15-23)17-9-16-24-21-12-7-4-8-13-21/h3-8,10-13,24H,2,9,14-19H2,1H3 |
| InChIKey | PXXKIYPSXYFATG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|