C16H20FN3O2 — CID 127054389
N-[(2S)-1-(2-cyanoethylamino)-3-methyl-1-oxopentan-2-yl]-2-fluorobenzamide (PubChem CID 127054389) has the molecular formula C16H20FN3O2 and a molecular weight of 305.35 g/mol. Its IUPAC name is N-[(2S)-1-(2-cyanoethylamino)-3-methyl-1-oxopentan-2-yl]-2-fluorobenzamide.
| Compound Name | N-[(2S)-1-(2-cyanoethylamino)-3-methyl-1-oxopentan-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 127054389 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | N-[(2S)-1-(2-cyanoethylamino)-3-methyl-1-oxopentan-2-yl]-2-fluorobenzamide |
| SMILES | CCC(C)[C@H](NC(=O)c1ccccc1F)C(=O)NCCC#N |
| InChI | InChI=1S/C16H20FN3O2/c1-3-11(2)14(16(22)19-10-6-9-18)20-15(21)12-7-4-5-8-13(12)17/h4-5,7-8,11,14H,3,6,10H2,1-2H3,(H,19,22)(H,20,21)/t11?,14-/m0/s1 |
| InChIKey | YWRJLTKJUJIAFM-IAXJKZSUSA-N |
| XLogP | 2.00 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|