C20H19FN4O4 — CID 1270670
ethyl (1R,2R,3S,8aS)-3,6-dicarbamoyl-1-cyano-2-(2-fluorophenyl)-3,8a-dihydro-2H-indolizine-1-carboxylate (PubChem CID 1270670) has the molecular formula C20H19FN4O4 and a molecular weight of 398.39 g/mol. Its IUPAC name is ethyl (1R,2R,3S,8aS)-3,6-dicarbamoyl-1-cyano-2-(2-fluorophenyl)-3,8a-dihydro-2H-indolizine-1-carboxylate.
| Compound Name | ethyl (1R,2R,3S,8aS)-3,6-dicarbamoyl-1-cyano-2-(2-fluorophenyl)-3,8a-dihydro-2H-indolizine-1-carboxylate |
|---|---|
| PubChem CID | 1270670 |
| Molecular Formula | C20H19FN4O4 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | ethyl (1R,2R,3S,8aS)-3,6-dicarbamoyl-1-cyano-2-(2-fluorophenyl)-3,8a-dihydro-2H-indolizine-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C#N)[C@H](c2ccccc2F)[C@@H](C(N)=O)N2C=C(C(N)=O)C=C[C@H]21 |
| InChI | InChI=1S/C20H19FN4O4/c1-2-29-19(28)20(10-22)14-8-7-11(17(23)26)9-25(14)16(18(24)27)15(20)12-5-3-4-6-13(12)21/h3-9,14-16H,2H2,1H3,(H2,23,26)(H2,24,27)/t14-,15+,16-,20-/m0/s1 |
| InChIKey | RRLSWKYRRUHRJB-QOIOWGMHSA-N |
| XLogP | 0.46 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |