C14H12ClN3O4S — CID 127074411
1-(5-chloro-2-hydroxyphenyl)-3-(2-methoxy-4-nitrophenyl)thiourea (PubChem CID 127074411) has the molecular formula C14H12ClN3O4S and a molecular weight of 353.79 g/mol. Its IUPAC name is 1-(5-chloro-2-hydroxyphenyl)-3-(2-methoxy-4-nitrophenyl)thiourea.
| Compound Name | 1-(5-chloro-2-hydroxyphenyl)-3-(2-methoxy-4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 127074411 |
| Molecular Formula | C14H12ClN3O4S |
| Molecular Weight | 353.79 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 1-(5-chloro-2-hydroxyphenyl)-3-(2-methoxy-4-nitrophenyl)thiourea |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=S)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C14H12ClN3O4S/c1-22-13-7-9(18(20)21)3-4-10(13)16-14(23)17-11-6-8(15)2-5-12(11)19/h2-7,19H,1H3,(H2,16,17,23) |
| InChIKey | AVCPZWZCLMKAFF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.79 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|