C14H11Cl3N4O5S2 — CID 3360566
1-(2-methoxy-4-nitrophenyl)-3-[(2,4,5-trichlorophenyl)sulfonylamino]thiourea (PubChem CID 3360566) has the molecular formula C14H11Cl3N4O5S2 and a molecular weight of 485.76 g/mol. Its IUPAC name is 1-(2-methoxy-4-nitrophenyl)-3-[(2,4,5-trichlorophenyl)sulfonylamino]thiourea.
| Compound Name | 1-(2-methoxy-4-nitrophenyl)-3-[(2,4,5-trichlorophenyl)sulfonylamino]thiourea |
|---|---|
| PubChem CID | 3360566 |
| Molecular Formula | C14H11Cl3N4O5S2 |
| Molecular Weight | 485.76 g/mol |
| Exact Mass | 483.92 |
| IUPAC Name | 1-(2-methoxy-4-nitrophenyl)-3-[(2,4,5-trichlorophenyl)sulfonylamino]thiourea |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=S)NNS(=O)(=O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl3N4O5S2/c1-26-12-4-7(21(22)23)2-3-11(12)18-14(27)19-20-28(24,25)13-6-9(16)8(15)5-10(13)17/h2-6,20H,1H3,(H2,18,19,27) |
| InChIKey | FOHJFVNHMKBGSJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.76 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|