C7H18N2O6S2 — CID 12708925
[2-methyl-2-(sulfamoyloxymethyl)pentyl] sulfamate (PubChem CID 12708925) has the molecular formula C7H18N2O6S2 and a molecular weight of 290.36 g/mol. Its IUPAC name is [2-methyl-2-(sulfamoyloxymethyl)pentyl] sulfamate.
| Compound Name | [2-methyl-2-(sulfamoyloxymethyl)pentyl] sulfamate |
|---|---|
| PubChem CID | 12708925 |
| Molecular Formula | C7H18N2O6S2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | [2-methyl-2-(sulfamoyloxymethyl)pentyl] sulfamate |
| SMILES | CCCC(C)(COS(N)(=O)=O)COS(N)(=O)=O |
| InChI | InChI=1S/C7H18N2O6S2/c1-3-4-7(2,5-14-16(8,10)11)6-15-17(9,12)13/h3-6H2,1-2H3,(H2,8,10,11)(H2,9,12,13) |
| InChIKey | QJQKZZCQOQXBQF-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |