C14H12Br2N2O2S — CID 1271118
N-[(4-bromo-5-methylthiophen-2-yl)methylideneamino]-2-(2-bromophenoxy)acetamide (PubChem CID 1271118) has the molecular formula C14H12Br2N2O2S and a molecular weight of 432.14 g/mol. Its IUPAC name is N-[(4-bromo-5-methylthiophen-2-yl)methylideneamino]-2-(2-bromophenoxy)acetamide.
| Compound Name | N-[(4-bromo-5-methylthiophen-2-yl)methylideneamino]-2-(2-bromophenoxy)acetamide |
|---|---|
| PubChem CID | 1271118 |
| Molecular Formula | C14H12Br2N2O2S |
| Molecular Weight | 432.14 g/mol |
| Exact Mass | 429.90 |
| IUPAC Name | N-[(4-bromo-5-methylthiophen-2-yl)methylideneamino]-2-(2-bromophenoxy)acetamide |
| SMILES | Cc1sc(C=NNC(=O)COc2ccccc2Br)cc1Br |
| InChI | InChI=1S/C14H12Br2N2O2S/c1-9-12(16)6-10(21-9)7-17-18-14(19)8-20-13-5-3-2-4-11(13)15/h2-7H,8H2,1H3,(H,18,19) |
| InChIKey | ITCUVWGAPSIQGI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.14 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|