C20H23NO — CID 12712295
N-[(2S)-1-methoxy-3-phenylpropan-2-yl]-3,4-dihydro-2H-naphthalen-1-imine (PubChem CID 12712295) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is N-[(2S)-1-methoxy-3-phenylpropan-2-yl]-3,4-dihydro-2H-naphthalen-1-imine.
| Compound Name | N-[(2S)-1-methoxy-3-phenylpropan-2-yl]-3,4-dihydro-2H-naphthalen-1-imine |
|---|---|
| PubChem CID | 12712295 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N-[(2S)-1-methoxy-3-phenylpropan-2-yl]-3,4-dihydro-2H-naphthalen-1-imine |
| SMILES | COC[C@H](Cc1ccccc1)/N=C1\CCCc2ccccc21 |
| InChI | InChI=1S/C20H23NO/c1-22-15-18(14-16-8-3-2-4-9-16)21-20-13-7-11-17-10-5-6-12-19(17)20/h2-6,8-10,12,18H,7,11,13-15H2,1H3/b21-20+/t18-/m0/s1 |
| InChIKey | KWKQGJCYODRAHR-MKSIGINJSA-N |
| XLogP | 4.07 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|