C18H24F3N3O3 — CID 127145276
4-(pentanoylamino)-N-[3-(trifluoromethoxy)phenyl]piperidine-1-carboxamide (PubChem CID 127145276) has the molecular formula C18H24F3N3O3 and a molecular weight of 387.40 g/mol. Its IUPAC name is 4-(pentanoylamino)-N-[3-(trifluoromethoxy)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-(pentanoylamino)-N-[3-(trifluoromethoxy)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 127145276 |
| Molecular Formula | C18H24F3N3O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 4-(pentanoylamino)-N-[3-(trifluoromethoxy)phenyl]piperidine-1-carboxamide |
| SMILES | CCCCC(=O)NC1CCN(C(=O)Nc2cccc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H24F3N3O3/c1-2-3-7-16(25)22-13-8-10-24(11-9-13)17(26)23-14-5-4-6-15(12-14)27-18(19,20)21/h4-6,12-13H,2-3,7-11H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | KMWDFKAIXQAVKI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |