C19H26BrN3O2 — CID 127145539
N-(4-bromophenyl)-4-(cyclohexanecarbonylamino)piperidine-1-carboxamide (PubChem CID 127145539) has the molecular formula C19H26BrN3O2 and a molecular weight of 408.34 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-(cyclohexanecarbonylamino)piperidine-1-carboxamide.
| Compound Name | N-(4-bromophenyl)-4-(cyclohexanecarbonylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 127145539 |
| Molecular Formula | C19H26BrN3O2 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-(4-bromophenyl)-4-(cyclohexanecarbonylamino)piperidine-1-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)Nc2ccc(Br)cc2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C19H26BrN3O2/c20-15-6-8-16(9-7-15)22-19(25)23-12-10-17(11-13-23)21-18(24)14-4-2-1-3-5-14/h6-9,14,17H,1-5,10-13H2,(H,21,24)(H,22,25) |
| InChIKey | MLQHIISSKDXCIS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |