C24H12O12S — CID 12714697
1-hydroxy-12-sulfoperylene-3,4,9,10-tetracarboxylic acid (PubChem CID 12714697) has the molecular formula C24H12O12S and a molecular weight of 524.42 g/mol. Its IUPAC name is 1-hydroxy-12-sulfoperylene-3,4,9,10-tetracarboxylic acid.
| Compound Name | 1-hydroxy-12-sulfoperylene-3,4,9,10-tetracarboxylic acid |
|---|---|
| PubChem CID | 12714697 |
| Molecular Formula | C24H12O12S |
| Molecular Weight | 524.42 g/mol |
| Exact Mass | 524.00 |
| IUPAC Name | 1-hydroxy-12-sulfoperylene-3,4,9,10-tetracarboxylic acid |
| SMILES | O=C(O)c1ccc2c3ccc(C(=O)O)c4c(C(=O)O)cc(S(=O)(=O)O)c(c5c(O)cc(C(=O)O)c1c25)c43 |
| InChI | InChI=1S/C24H12O12S/c25-13-5-11(23(30)31)15-9(21(26)27)3-1-7-8-2-4-10(22(28)29)16-12(24(32)33)6-14(37(34,35)36)20(18(8)16)19(13)17(7)15/h1-6,25H,(H,26,27)(H,28,29)(H,30,31)(H,32,33)(H,34,35,36) |
| InChIKey | KKCFMTRAIGEINQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|