C24H14O8S2 — CID 91023740
6-naphthalen-2-yloxysulfonyl-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 91023740) has the molecular formula C24H14O8S2 and a molecular weight of 494.50 g/mol. Its IUPAC name is 6-naphthalen-2-yloxysulfonyl-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 6-naphthalen-2-yloxysulfonyl-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 91023740 |
| Molecular Formula | C24H14O8S2 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | 6-naphthalen-2-yloxysulfonyl-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | O=C1c2ccc(S(=O)(=O)Oc3ccc4ccccc4c3)cc2C(=O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C24H14O8S2/c25-23-20-10-8-18(34(30,31)32-16-6-5-14-3-1-2-4-15(14)11-16)13-22(20)24(26)19-9-7-17(12-21(19)23)33(27,28)29/h1-13H,(H,27,28,29) |
| InChIKey | WGEYVHKQGRWAED-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|