C27H23F3O7S2 — CID 158927862
6-(benzenesulfonyl)-3,4-dihydro-2H-naphthalen-1-one;(5-oxo-7,8-dihydro-6H-naphthalen-2-yl) trifluoromethanesulfonate (PubChem CID 158927862) has the molecular formula C27H23F3O7S2 and a molecular weight of 580.60 g/mol. Its IUPAC name is 6-(benzenesulfonyl)-3,4-dihydro-2H-naphthalen-1-one;(5-oxo-7,8-dihydro-6H-naphthalen-2-yl) trifluoromethanesulfonate.
| Compound Name | 6-(benzenesulfonyl)-3,4-dihydro-2H-naphthalen-1-one;(5-oxo-7,8-dihydro-6H-naphthalen-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158927862 |
| Molecular Formula | C27H23F3O7S2 |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.08 |
| IUPAC Name | 6-(benzenesulfonyl)-3,4-dihydro-2H-naphthalen-1-one;(5-oxo-7,8-dihydro-6H-naphthalen-2-yl) trifluoromethanesulfonate |
| SMILES | O=C1CCCc2cc(OS(=O)(=O)C(F)(F)F)ccc21.O=C1CCCc2cc(S(=O)(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C16H14O3S.C11H9F3O4S/c17-16-8-4-5-12-11-14(9-10-15(12)16)20(18,19)13-6-2-1-3-7-13;12-11(13,14)19(16,17)18-8-4-5-9-7(6-8)2-1-3-10(9)15/h1-3,6-7,9-11H,4-5,8H2;4-6H,1-3H2 |
| InChIKey | JIQZVMPSCAPRLO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 111.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|