C17H15FO4S — CID 154713424
[(6R)-6-fluoro-5-oxo-7,8-dihydro-6H-naphthalen-2-yl] 4-methylbenzenesulfonate (PubChem CID 154713424) has the molecular formula C17H15FO4S and a molecular weight of 334.37 g/mol. Its IUPAC name is [(6R)-6-fluoro-5-oxo-7,8-dihydro-6H-naphthalen-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(6R)-6-fluoro-5-oxo-7,8-dihydro-6H-naphthalen-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 154713424 |
| Molecular Formula | C17H15FO4S |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | [(6R)-6-fluoro-5-oxo-7,8-dihydro-6H-naphthalen-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc3c(c2)CC[C@@H](F)C3=O)cc1 |
| InChI | InChI=1S/C17H15FO4S/c1-11-2-6-14(7-3-11)23(20,21)22-13-5-8-15-12(10-13)4-9-16(18)17(15)19/h2-3,5-8,10,16H,4,9H2,1H3/t16-/m1/s1 |
| InChIKey | QPZPUTPMYASCBH-MRXNPFEDSA-N |
| XLogP | 3.23 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|