C35H23F9O5S2 — CID 142331762
[[4-[4-(4-hydroxyphenyl)benzoyl]phenyl]-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 142331762) has the molecular formula C35H23F9O5S2 and a molecular weight of 758.68 g/mol. Its IUPAC name is [[4-[4-(4-hydroxyphenyl)benzoyl]phenyl]-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [[4-[4-(4-hydroxyphenyl)benzoyl]phenyl]-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 142331762 |
| Molecular Formula | C35H23F9O5S2 |
| Molecular Weight | 758.68 g/mol |
| Exact Mass | 758.08 |
| IUPAC Name | [[4-[4-(4-hydroxyphenyl)benzoyl]phenyl]-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=C(c1ccc(-c2ccc(O)cc2)cc1)c1ccc(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H23F9O5S2/c36-32(37,34(40,41)42)33(38,39)35(43,44)51(47,48)49-50(28-7-3-1-4-8-28,29-9-5-2-6-10-29)30-21-17-26(18-22-30)31(46)25-13-11-23(12-14-25)24-15-19-27(45)20-16-24/h1-22,45H |
| InChIKey | VLJPYXKXGUCHDE-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.68 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|