C23H11F3O5S — CID 58757844
(6,13-dioxopentacen-2-yl) trifluoromethanesulfonate (PubChem CID 58757844) has the molecular formula C23H11F3O5S and a molecular weight of 456.40 g/mol. Its IUPAC name is (6,13-dioxopentacen-2-yl) trifluoromethanesulfonate.
| Compound Name | (6,13-dioxopentacen-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58757844 |
| Molecular Formula | C23H11F3O5S |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | (6,13-dioxopentacen-2-yl) trifluoromethanesulfonate |
| SMILES | O=C1c2cc3ccccc3cc2C(=O)c2cc3cc(OS(=O)(=O)C(F)(F)F)ccc3cc21 |
| InChI | InChI=1S/C23H11F3O5S/c24-23(25,26)32(29,30)31-16-6-5-14-10-19-20(11-15(14)7-16)22(28)18-9-13-4-2-1-3-12(13)8-17(18)21(19)27/h1-11H |
| InChIKey | FBEZAMPLVXHKHD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|