C12H20OS — CID 12715916
1-[(E)-3-tert-butylsulfanylprop-2-enyl]cyclopent-2-en-1-ol (PubChem CID 12715916) has the molecular formula C12H20OS and a molecular weight of 212.36 g/mol. Its IUPAC name is 1-[(E)-3-tert-butylsulfanylprop-2-enyl]cyclopent-2-en-1-ol.
| Compound Name | 1-[(E)-3-tert-butylsulfanylprop-2-enyl]cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 12715916 |
| Molecular Formula | C12H20OS |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-[(E)-3-tert-butylsulfanylprop-2-enyl]cyclopent-2-en-1-ol |
| SMILES | CC(C)(C)S/C=C/CC1(O)C=CCC1 |
| InChI | InChI=1S/C12H20OS/c1-11(2,3)14-10-6-9-12(13)7-4-5-8-12/h4,6-7,10,13H,5,8-9H2,1-3H3/b10-6+ |
| InChIKey | BAVLAOXIJNGQOT-UXBLZVDNSA-N |
| XLogP | 3.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|