C13H22OS — CID 86596502
1-(2-ethylsulfanylethyl)-2,3,5-trimethylcyclohexa-2,4-dien-1-ol (PubChem CID 86596502) has the molecular formula C13H22OS and a molecular weight of 226.38 g/mol. Its IUPAC name is 1-(2-ethylsulfanylethyl)-2,3,5-trimethylcyclohexa-2,4-dien-1-ol.
| Compound Name | 1-(2-ethylsulfanylethyl)-2,3,5-trimethylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 86596502 |
| Molecular Formula | C13H22OS |
| Molecular Weight | 226.38 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 1-(2-ethylsulfanylethyl)-2,3,5-trimethylcyclohexa-2,4-dien-1-ol |
| SMILES | CCSCCC1(O)CC(C)=CC(C)=C1C |
| InChI | InChI=1S/C13H22OS/c1-5-15-7-6-13(14)9-10(2)8-11(3)12(13)4/h8,14H,5-7,9H2,1-4H3 |
| InChIKey | NQHRZDUAGHQFAJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|