C13H26OS — CID 14153383
(3R)-3,7-dimethyl-1-propan-2-ylsulfanyloct-6-en-3-ol (PubChem CID 14153383) has the molecular formula C13H26OS and a molecular weight of 230.42 g/mol. Its IUPAC name is (3R)-3,7-dimethyl-1-propan-2-ylsulfanyloct-6-en-3-ol.
| Compound Name | (3R)-3,7-dimethyl-1-propan-2-ylsulfanyloct-6-en-3-ol |
|---|---|
| PubChem CID | 14153383 |
| Molecular Formula | C13H26OS |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (3R)-3,7-dimethyl-1-propan-2-ylsulfanyloct-6-en-3-ol |
| SMILES | CC(C)=CCC[C@@](C)(O)CCSC(C)C |
| InChI | InChI=1S/C13H26OS/c1-11(2)7-6-8-13(5,14)9-10-15-12(3)4/h7,12,14H,6,8-10H2,1-5H3/t13-/m1/s1 |
| InChIKey | DZOKEYAFJBLABI-CYBMUJFWSA-N |
| XLogP | 4.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|