C9H8O3 — CID 12719135
(2-oxo-1-bicyclo[3.2.0]hepta-3,6-dienyl) acetate (PubChem CID 12719135) has the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. Its IUPAC name is (2-oxo-1-bicyclo[3.2.0]hepta-3,6-dienyl) acetate.
| Compound Name | (2-oxo-1-bicyclo[3.2.0]hepta-3,6-dienyl) acetate |
|---|---|
| PubChem CID | 12719135 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | (2-oxo-1-bicyclo[3.2.0]hepta-3,6-dienyl) acetate |
| SMILES | CC(=O)OC12C=CC1C=CC2=O |
| InChI | InChI=1S/C9H8O3/c1-6(10)12-9-5-4-7(9)2-3-8(9)11/h2-5,7H,1H3 |
| InChIKey | CAWYLDHPOXWPEU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|